C19H27N3O5 — CID 135012619
4-(azidomethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)-phenylmethoxymethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 135012619) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-(azidomethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)-phenylmethoxymethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-(azidomethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)-phenylmethoxymethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 135012619 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-(azidomethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)-phenylmethoxymethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(C(OCc2ccccc2)C2OC(C)(C)OC2CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C19H27N3O5/c1-18(2)24-12-15(26-18)16(23-11-13-8-6-5-7-9-13)17-14(10-21-22-20)25-19(3,4)27-17/h5-9,14-17H,10-12H2,1-4H3 |
| InChIKey | LJJWQYRZKLJAQZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|