C31H64O2Si3 — CID 135013689
tert-butyl-dimethyl-[(2R,5S)-2-methyl-3-methylidene-5-triethylsilyloxy-8-tri(propan-2-yl)silyloct-7-ynoxy]silane (PubChem CID 135013689) has the molecular formula C31H64O2Si3 and a molecular weight of 553.11 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,5S)-2-methyl-3-methylidene-5-triethylsilyloxy-8-tri(propan-2-yl)silyloct-7-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2R,5S)-2-methyl-3-methylidene-5-triethylsilyloxy-8-tri(propan-2-yl)silyloct-7-ynoxy]silane |
|---|---|
| PubChem CID | 135013689 |
| Molecular Formula | C31H64O2Si3 |
| Molecular Weight | 553.11 g/mol |
| Exact Mass | 552.42 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,5S)-2-methyl-3-methylidene-5-triethylsilyloxy-8-tri(propan-2-yl)silyloct-7-ynoxy]silane |
| SMILES | C=C(C[C@@H](CC#C[Si](C(C)C)(C(C)C)C(C)C)O[Si](CC)(CC)CC)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O2Si3/c1-17-35(18-2,19-3)33-30(21-20-22-36(25(4)5,26(6)7)27(8)9)23-28(10)29(11)24-32-34(15,16)31(12,13)14/h25-27,29-30H,10,17-19,21,23-24H2,1-9,11-16H3/t29-,30+/m0/s1 |
| InChIKey | BRFGBXRRKNWPNK-XZWHSSHBSA-N |
| XLogP | 10.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.11 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|