C21H40O2Si — CID 91742534
2,7-dimethyloct-7-en-5-yn-4-yloxy-diethyl-heptoxysilane (PubChem CID 91742534) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is 2,7-dimethyloct-7-en-5-yn-4-yloxy-diethyl-heptoxysilane.
| Compound Name | 2,7-dimethyloct-7-en-5-yn-4-yloxy-diethyl-heptoxysilane |
|---|---|
| PubChem CID | 91742534 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 2,7-dimethyloct-7-en-5-yn-4-yloxy-diethyl-heptoxysilane |
| SMILES | C=C(C)C#CC(CC(C)C)O[Si](CC)(CC)OCCCCCCC |
| InChI | InChI=1S/C21H40O2Si/c1-8-11-12-13-14-17-22-24(9-2,10-3)23-21(18-20(6)7)16-15-19(4)5/h20-21H,4,8-14,17-18H2,1-3,5-7H3 |
| InChIKey | BKKXZJAVIVEZRV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|