C23H28N4O6Si — CID 135015762
diethyl (13S,16R)-11,15-dioxo-4-(2-trimethylsilylethynyl)-1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3(8),4,6-triene-13,16-dicarboxylate (PubChem CID 135015762) has the molecular formula C23H28N4O6Si and a molecular weight of 484.59 g/mol. Its IUPAC name is diethyl (13S,16R)-11,15-dioxo-4-(2-trimethylsilylethynyl)-1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3(8),4,6-triene-13,16-dicarboxylate.
| Compound Name | diethyl (13S,16R)-11,15-dioxo-4-(2-trimethylsilylethynyl)-1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3(8),4,6-triene-13,16-dicarboxylate |
|---|---|
| PubChem CID | 135015762 |
| Molecular Formula | C23H28N4O6Si |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | diethyl (13S,16R)-11,15-dioxo-4-(2-trimethylsilylethynyl)-1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3(8),4,6-triene-13,16-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12NC(=O)N3Cc4cccc(C#C[Si](C)(C)C)c4CN(C(=O)N1)[C@]32C(=O)OCC |
| InChI | InChI=1S/C23H28N4O6Si/c1-6-32-18(28)22-23(19(29)33-7-2)26(20(30)24-22)13-16-10-8-9-15(11-12-34(3,4)5)17(16)14-27(23)21(31)25-22/h8-10H,6-7,13-14H2,1-5H3,(H,24,30)(H,25,31)/t22-,23+/m1/s1 |
| InChIKey | CXEYJWPZAPLZRS-PKTZIBPZSA-N |
| XLogP | 1.50 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|