C17H20INO5 — CID 122454117
diethyl 2-acetyl-8-iodo-1,4-dihydroisoquinoline-3,3-dicarboxylate (PubChem CID 122454117) has the molecular formula C17H20INO5 and a molecular weight of 445.25 g/mol. Its IUPAC name is diethyl 2-acetyl-8-iodo-1,4-dihydroisoquinoline-3,3-dicarboxylate.
| Compound Name | diethyl 2-acetyl-8-iodo-1,4-dihydroisoquinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 122454117 |
| Molecular Formula | C17H20INO5 |
| Molecular Weight | 445.25 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | diethyl 2-acetyl-8-iodo-1,4-dihydroisoquinoline-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2cccc(I)c2CN1C(C)=O |
| InChI | InChI=1S/C17H20INO5/c1-4-23-15(21)17(16(22)24-5-2)9-12-7-6-8-14(18)13(12)10-19(17)11(3)20/h6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | HPYRXBJHGOZLER-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|