C17H19I2NO5 — CID 102172725
diethyl 2-acetyl-6,7-diiodo-1,4-dihydroisoquinoline-3,3-dicarboxylate (PubChem CID 102172725) has the molecular formula C17H19I2NO5 and a molecular weight of 571.15 g/mol. Its IUPAC name is diethyl 2-acetyl-6,7-diiodo-1,4-dihydroisoquinoline-3,3-dicarboxylate.
| Compound Name | diethyl 2-acetyl-6,7-diiodo-1,4-dihydroisoquinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102172725 |
| Molecular Formula | C17H19I2NO5 |
| Molecular Weight | 571.15 g/mol |
| Exact Mass | 570.94 |
| IUPAC Name | diethyl 2-acetyl-6,7-diiodo-1,4-dihydroisoquinoline-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2cc(I)c(I)cc2CN1C(C)=O |
| InChI | InChI=1S/C17H19I2NO5/c1-4-24-15(22)17(16(23)25-5-2)8-11-6-13(18)14(19)7-12(11)9-20(17)10(3)21/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | MWEMYTDDRQHKFW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|