C24H37NO4Si — CID 135022738
(4S)-3-[(3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-3-methylhexanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 135022738) has the molecular formula C24H37NO4Si and a molecular weight of 431.65 g/mol. Its IUPAC name is (4S)-3-[(3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-3-methylhexanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-3-methylhexanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135022738 |
| Molecular Formula | C24H37NO4Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (4S)-3-[(3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-3-methylhexanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@](C)(CCCO[Si](C)(C)C(C)(C)C)CC(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H37NO4Si/c1-8-24(5,15-12-16-29-30(6,7)23(2,3)4)17-21(26)25-20(18-28-22(25)27)19-13-10-9-11-14-19/h8-11,13-14,20H,1,12,15-18H2,2-7H3/t20-,24-/m1/s1 |
| InChIKey | DBPKVFAZZLDGQO-HYBUGGRVSA-N |
| XLogP | 6.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|