C19H27NO5 — CID 135026138
[5-ethoxy-4-methyl-2-methylidene-5-(phenylmethoxycarbonylamino)pentyl] acetate (PubChem CID 135026138) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is [5-ethoxy-4-methyl-2-methylidene-5-(phenylmethoxycarbonylamino)pentyl] acetate.
| Compound Name | [5-ethoxy-4-methyl-2-methylidene-5-(phenylmethoxycarbonylamino)pentyl] acetate |
|---|---|
| PubChem CID | 135026138 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [5-ethoxy-4-methyl-2-methylidene-5-(phenylmethoxycarbonylamino)pentyl] acetate |
| SMILES | C=C(COC(C)=O)CC(C)C(NC(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C19H27NO5/c1-5-23-18(15(3)11-14(2)12-24-16(4)21)20-19(22)25-13-17-9-7-6-8-10-17/h6-10,15,18H,2,5,11-13H2,1,3-4H3,(H,20,22) |
| InChIKey | UEQKWVYPWMWLLQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|