C25H32INO3Si — CID 135027128
(4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E,2R)-4-iodopent-3-en-2-yl]-1,3-oxazolidin-2-one (PubChem CID 135027128) has the molecular formula C25H32INO3Si and a molecular weight of 549.53 g/mol. Its IUPAC name is (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E,2R)-4-iodopent-3-en-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E,2R)-4-iodopent-3-en-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135027128 |
| Molecular Formula | C25H32INO3Si |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E,2R)-4-iodopent-3-en-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C/C(I)=C\[C@@H](C)[C@H]1OC(=O)N[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32INO3Si/c1-18(16-19(2)26)23-22(27-24(28)30-23)17-29-31(25(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-16,18,22-23H,17H2,1-5H3,(H,27,28)/b19-16+/t18-,22+,23-/m1/s1 |
| InChIKey | QYMWZKFBPZSRMT-CWMWVBSKSA-N |
| XLogP | 5.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|