C31H42N2O6 — CID 135030314
[(2R,3R,4R,5R)-5-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol (PubChem CID 135030314) has the molecular formula C31H42N2O6 and a molecular weight of 538.69 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R)-5-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 135030314 |
| Molecular Formula | C31H42N2O6 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[[(2S,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1C[C@H]1O[C@H](CO)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H42N2O6/c1-5-35-30-24(32-31(36-6-2)27(33-30)21(3)4)17-25-28(37-19-22-13-9-7-10-14-22)29(26(18-34)39-25)38-20-23-15-11-8-12-16-23/h7-16,21,24-29,34H,5-6,17-20H2,1-4H3/t24-,25+,26+,27+,28+,29+/m0/s1 |
| InChIKey | WAVXGVOQNALKTR-ZHMMVFJOSA-N |
| XLogP | 4.58 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |