C22H24ClNO2 — CID 135030406
(3R)-7-chloro-1,3-dimethyl-3-(4-oxo-6-phenylhexyl)indol-2-one (PubChem CID 135030406) has the molecular formula C22H24ClNO2 and a molecular weight of 369.89 g/mol. Its IUPAC name is (3R)-7-chloro-1,3-dimethyl-3-(4-oxo-6-phenylhexyl)indol-2-one.
| Compound Name | (3R)-7-chloro-1,3-dimethyl-3-(4-oxo-6-phenylhexyl)indol-2-one |
|---|---|
| PubChem CID | 135030406 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (3R)-7-chloro-1,3-dimethyl-3-(4-oxo-6-phenylhexyl)indol-2-one |
| SMILES | CN1C(=O)[C@](C)(CCCC(=O)CCc2ccccc2)c2cccc(Cl)c21 |
| InChI | InChI=1S/C22H24ClNO2/c1-22(18-11-6-12-19(23)20(18)24(2)21(22)26)15-7-10-17(25)14-13-16-8-4-3-5-9-16/h3-6,8-9,11-12H,7,10,13-15H2,1-2H3/t22-/m1/s1 |
| InChIKey | RMIZHBAOLCQGDT-JOCHJYFZSA-N |
| XLogP | 4.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |