C16H22F2N2O2 — CID 135030966
ethyl (3E)-3-(dimethylhydrazinylidene)-2,2-difluoro-3-(2,4,6-trimethylphenyl)propanoate (PubChem CID 135030966) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is ethyl (3E)-3-(dimethylhydrazinylidene)-2,2-difluoro-3-(2,4,6-trimethylphenyl)propanoate.
| Compound Name | ethyl (3E)-3-(dimethylhydrazinylidene)-2,2-difluoro-3-(2,4,6-trimethylphenyl)propanoate |
|---|---|
| PubChem CID | 135030966 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethyl (3E)-3-(dimethylhydrazinylidene)-2,2-difluoro-3-(2,4,6-trimethylphenyl)propanoate |
| SMILES | CCOC(=O)C(F)(F)/C(=N/N(C)C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H22F2N2O2/c1-7-22-15(21)16(17,18)14(19-20(5)6)13-11(3)8-10(2)9-12(13)4/h8-9H,7H2,1-6H3/b19-14+ |
| InChIKey | ZAVGLELDBLTHCA-XMHGGMMESA-N |
| XLogP | 3.08 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|