C20H25F3N2O3 — CID 57159119
propyl 6-(2-ethoxyethyl)-3-methyl-5-[2-(trifluoromethyl)phenyl]-4,5-dihydropyridazine-4-carboxylate (PubChem CID 57159119) has the molecular formula C20H25F3N2O3 and a molecular weight of 398.43 g/mol. Its IUPAC name is propyl 6-(2-ethoxyethyl)-3-methyl-5-[2-(trifluoromethyl)phenyl]-4,5-dihydropyridazine-4-carboxylate.
| Compound Name | propyl 6-(2-ethoxyethyl)-3-methyl-5-[2-(trifluoromethyl)phenyl]-4,5-dihydropyridazine-4-carboxylate |
|---|---|
| PubChem CID | 57159119 |
| Molecular Formula | C20H25F3N2O3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | propyl 6-(2-ethoxyethyl)-3-methyl-5-[2-(trifluoromethyl)phenyl]-4,5-dihydropyridazine-4-carboxylate |
| SMILES | CCCOC(=O)C1C(C)=NN=C(CCOCC)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H25F3N2O3/c1-4-11-28-19(26)17-13(3)24-25-16(10-12-27-5-2)18(17)14-8-6-7-9-15(14)20(21,22)23/h6-9,17-18H,4-5,10-12H2,1-3H3 |
| InChIKey | SRIALHYXDDOJLH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|