C34H38N2P2 — CID 135031957
(4S,9S)-18,21-diphenyl-3,10-diaza-18,21-diphosphatetracyclo[20.4.0.04,9.012,17]hexacosa-1(26),12,14,16,22,24-hexaene (PubChem CID 135031957) has the molecular formula C34H38N2P2 and a molecular weight of 536.64 g/mol. Its IUPAC name is (4S,9S)-18,21-diphenyl-3,10-diaza-18,21-diphosphatetracyclo[20.4.0.04,9.012,17]hexacosa-1(26),12,14,16,22,24-hexaene.
| Compound Name | (4S,9S)-18,21-diphenyl-3,10-diaza-18,21-diphosphatetracyclo[20.4.0.04,9.012,17]hexacosa-1(26),12,14,16,22,24-hexaene |
|---|---|
| PubChem CID | 135031957 |
| Molecular Formula | C34H38N2P2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | (4S,9S)-18,21-diphenyl-3,10-diaza-18,21-diphosphatetracyclo[20.4.0.04,9.012,17]hexacosa-1(26),12,14,16,22,24-hexaene |
| SMILES | c1ccc([P@@]2CC[P@@](c3ccccc3)c3ccccc3CN[C@H]3CCCC[C@@H]3NCc3ccccc32)cc1 |
| InChI | InChI=1S/C34H38N2P2/c1-3-15-29(16-4-1)37-23-24-38(30-17-5-2-6-18-30)34-22-12-8-14-28(34)26-36-32-20-10-9-19-31(32)35-25-27-13-7-11-21-33(27)37/h1-8,11-18,21-22,31-32,35-36H,9-10,19-20,23-26H2/t31-,32-,37-,38+/m0/s1 |
| InChIKey | UDAAAYSFAAAFMD-HCBCFAOASA-N |
| XLogP | 5.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|