C9H16N2 — CID 135035249
CID 135035249 (PubChem CID 135035249) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol.
| Compound Name | CID 135035249 |
|---|---|
| PubChem CID | 135035249 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | — |
| SMILES | CN1[C]N(C)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C9H16N2/c1-10-7-11(2)9-6-4-3-5-8(9)10/h8-9H,3-6H2,1-2H3/t8-,9+ |
| InChIKey | JWBGXDJWOFPCIH-DTORHVGOSA-N |
| XLogP | 1.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |