C8H16O4S — CID 135037964
1-(2,3,3-trimethyloxiran-2-yl)ethyl methanesulfonate (PubChem CID 135037964) has the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-(2,3,3-trimethyloxiran-2-yl)ethyl methanesulfonate.
| Compound Name | 1-(2,3,3-trimethyloxiran-2-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 135037964 |
| Molecular Formula | C8H16O4S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-(2,3,3-trimethyloxiran-2-yl)ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)C1(C)OC1(C)C |
| InChI | InChI=1S/C8H16O4S/c1-6(11-13(5,9)10)8(4)7(2,3)12-8/h6H,1-5H3 |
| InChIKey | FANMGBYYELPDIH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|