C13H24O8S — CID 59169501
[(1R)-1-[(3aR,5R,6S,6aR)-5-[(1R)-1-hydroxyethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl] methanesulfonate (PubChem CID 59169501) has the molecular formula C13H24O8S and a molecular weight of 340.39 g/mol. Its IUPAC name is [(1R)-1-[(3aR,5R,6S,6aR)-5-[(1R)-1-hydroxyethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl] methanesulfonate.
| Compound Name | [(1R)-1-[(3aR,5R,6S,6aR)-5-[(1R)-1-hydroxyethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 59169501 |
| Molecular Formula | C13H24O8S |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(1R)-1-[(3aR,5R,6S,6aR)-5-[(1R)-1-hydroxyethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl] methanesulfonate |
| SMILES | CO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@]1([C@@H](C)O)[C@@H](C)OS(C)(=O)=O |
| InChI | InChI=1S/C13H24O8S/c1-7(14)13(8(2)21-22(6,15)16)10(17-5)9-11(20-13)19-12(3,4)18-9/h7-11,14H,1-6H3/t7-,8-,9-,10+,11+,13+/m1/s1 |
| InChIKey | OKQPEIDLJDGCHK-BNOQRQDOSA-N |
| XLogP | -0.01 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|