C12H20O10 — CID 135038192
(1S,2S,3R,5R,8R,12R,13R)-3-(hydroxymethyl)-4,6,9,14-tetraoxadispiro[4.2.58.25]pentadecane-1,2,11,12,13-pentol (PubChem CID 135038192) has the molecular formula C12H20O10 and a molecular weight of 324.28 g/mol. Its IUPAC name is (1S,2S,3R,5R,8R,12R,13R)-3-(hydroxymethyl)-4,6,9,14-tetraoxadispiro[4.2.58.25]pentadecane-1,2,11,12,13-pentol.
| Compound Name | (1S,2S,3R,5R,8R,12R,13R)-3-(hydroxymethyl)-4,6,9,14-tetraoxadispiro[4.2.58.25]pentadecane-1,2,11,12,13-pentol |
|---|---|
| PubChem CID | 135038192 |
| Molecular Formula | C12H20O10 |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (1S,2S,3R,5R,8R,12R,13R)-3-(hydroxymethyl)-4,6,9,14-tetraoxadispiro[4.2.58.25]pentadecane-1,2,11,12,13-pentol |
| SMILES | OC[C@H]1O[C@]2(CO[C@@]3(CO2)OCC(O)[C@@H](O)[C@H]3O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20O10/c13-1-6-8(16)10(18)12(22-6)4-20-11(3-21-12)9(17)7(15)5(14)2-19-11/h5-10,13-18H,1-4H2/t5?,6-,7-,8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | NMQBLDSHULSXOV-UMXKZHSSSA-N |
| XLogP | -4.35 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |