C12H19NO10 — CID 89126644
(3R,5R,8R,11R)-3-(hydroxymethyl)-11-nitroso-4,6,9,14-tetraoxadispiro[4.2.58.25]pentadecane-1,2,12,13-tetrol (PubChem CID 89126644) has the molecular formula C12H19NO10 and a molecular weight of 337.28 g/mol. Its IUPAC name is (3R,5R,8R,11R)-3-(hydroxymethyl)-11-nitroso-4,6,9,14-tetraoxadispiro[4.2.58.25]pentadecane-1,2,12,13-tetrol.
| Compound Name | (3R,5R,8R,11R)-3-(hydroxymethyl)-11-nitroso-4,6,9,14-tetraoxadispiro[4.2.58.25]pentadecane-1,2,12,13-tetrol |
|---|---|
| PubChem CID | 89126644 |
| Molecular Formula | C12H19NO10 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (3R,5R,8R,11R)-3-(hydroxymethyl)-11-nitroso-4,6,9,14-tetraoxadispiro[4.2.58.25]pentadecane-1,2,12,13-tetrol |
| SMILES | O=N[C@@H]1CO[C@@]2(CO[C@]3(CO2)O[C@H](CO)C(O)C3O)C(O)C1O |
| InChI | InChI=1S/C12H19NO10/c14-1-6-8(16)10(18)12(23-6)4-21-11(3-22-12)9(17)7(15)5(13-19)2-20-11/h5-10,14-18H,1-4H2/t5-,6-,7?,8?,9?,10?,11-,12-/m1/s1 |
| InChIKey | UTUXCEXNCYIPNX-SUQXEWLGSA-N |
| XLogP | -3.57 |
| TPSA | 167.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |