C13H26O5 — CID 135039854
(4S,5S)-4,5-bis(methoxymethoxy)non-1-en-3-ol (PubChem CID 135039854) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4S,5S)-4,5-bis(methoxymethoxy)non-1-en-3-ol.
| Compound Name | (4S,5S)-4,5-bis(methoxymethoxy)non-1-en-3-ol |
|---|---|
| PubChem CID | 135039854 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (4S,5S)-4,5-bis(methoxymethoxy)non-1-en-3-ol |
| SMILES | C=CC(O)[C@H](OCOC)[C@H](CCCC)OCOC |
| InChI | InChI=1S/C13H26O5/c1-5-7-8-12(17-9-15-3)13(11(14)6-2)18-10-16-4/h6,11-14H,2,5,7-10H2,1,3-4H3/t11?,12-,13-/m0/s1 |
| InChIKey | SYOBMODTAVUTGO-SPOOISQMSA-N |
| XLogP | 1.70 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|