C9H12O4S — CID 135039873
(3R,7S)-3-methyl-1,1-dioxo-3,4,7,8-tetrahydro-2,1λ6-benzoxathiin-7-ol (PubChem CID 135039873) has the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. Its IUPAC name is (3R,7S)-3-methyl-1,1-dioxo-3,4,7,8-tetrahydro-2,1λ6-benzoxathiin-7-ol.
| Compound Name | (3R,7S)-3-methyl-1,1-dioxo-3,4,7,8-tetrahydro-2,1λ6-benzoxathiin-7-ol |
|---|---|
| PubChem CID | 135039873 |
| Molecular Formula | C9H12O4S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (3R,7S)-3-methyl-1,1-dioxo-3,4,7,8-tetrahydro-2,1λ6-benzoxathiin-7-ol |
| SMILES | C[C@@H]1CC2=C(C[C@H](O)C=C2)S(=O)(=O)O1 |
| InChI | InChI=1S/C9H12O4S/c1-6-4-7-2-3-8(10)5-9(7)14(11,12)13-6/h2-3,6,8,10H,4-5H2,1H3/t6-,8-/m1/s1 |
| InChIKey | FAILOVOELMQAPY-HTRCEHHLSA-N |
| XLogP | 0.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|