C23H26O4 — CID 135041778
4-[(4R,5R)-2-but-3-enyl-4,5-diphenyl-1,3-dioxolan-2-yl]butanoic acid (PubChem CID 135041778) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[(4R,5R)-2-but-3-enyl-4,5-diphenyl-1,3-dioxolan-2-yl]butanoic acid.
| Compound Name | 4-[(4R,5R)-2-but-3-enyl-4,5-diphenyl-1,3-dioxolan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 135041778 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-[(4R,5R)-2-but-3-enyl-4,5-diphenyl-1,3-dioxolan-2-yl]butanoic acid |
| SMILES | C=CCCC1(CCCC(=O)O)O[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C23H26O4/c1-2-3-16-23(17-10-15-20(24)25)26-21(18-11-6-4-7-12-18)22(27-23)19-13-8-5-9-14-19/h2,4-9,11-14,21-22H,1,3,10,15-17H2,(H,24,25)/t21-,22-/m1/s1 |
| InChIKey | SJCDPBQQZQLEQR-FGZHOGPDSA-N |
| XLogP | 5.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|