C9H16O2 — CID 135042819
(2S,3S,5R)-5-ethyl-2-[(E)-prop-1-enyl]oxolan-3-ol (PubChem CID 135042819) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (2S,3S,5R)-5-ethyl-2-[(E)-prop-1-enyl]oxolan-3-ol.
| Compound Name | (2S,3S,5R)-5-ethyl-2-[(E)-prop-1-enyl]oxolan-3-ol |
|---|---|
| PubChem CID | 135042819 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2S,3S,5R)-5-ethyl-2-[(E)-prop-1-enyl]oxolan-3-ol |
| SMILES | C/C=C/[C@@H]1O[C@H](CC)C[C@@H]1O |
| InChI | InChI=1S/C9H16O2/c1-3-5-9-8(10)6-7(4-2)11-9/h3,5,7-10H,4,6H2,1-2H3/b5-3+/t7-,8+,9+/m1/s1 |
| InChIKey | PPCOVODTNDEAJR-BSOIJCQJSA-N |
| XLogP | 1.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|