About CID 135042991
CID 135042991 (PubChem CID 135042991) has the molecular formula C15H21O
and a molecular weight of 217.33 g/mol.
Molecular Properties
| Compound Name | CID 135042991 |
| PubChem CID | 135042991 |
| Molecular Formula | C15H21O |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | — |
| SMILES | CC(C)(O)CCC=CC[CH]c1ccccc1 |
| InChI | InChI=1S/C15H21O/c1-15(2,16)13-9-4-3-6-10-14-11-7-5-8-12-14/h3-5,7-8,10-12,16H,6,9,13H2,1-2H3 |
| InChIKey | ZKVOUFHRZSQSEM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 135042991 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135042991?
The IUPAC name of CID 135042991 (CID 135042991) is not available.
What is the SMILES notation for CID 135042991?
The canonical SMILES for CID 135042991 is CC(C)(O)CCC=CC[CH]c1ccccc1.
What is the InChIKey of CID 135042991?
The InChIKey is ZKVOUFHRZSQSEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21O/c1-15(2,16)13-9-4-3-6-10-14-11-7-5-8-12-14/h3-5,7-8,10-12,16H,6,9,13H2,1-2H3.
What are the key properties of CID 135042991?
CID 135042991 has a molecular weight of 217.33 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135042991 is sourced from PubChem (CID 135042991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).