C15H21O — CID 135042991
CID 135042991 (PubChem CID 135042991) has the molecular formula C15H21O and a molecular weight of 217.33 g/mol.
| Compound Name | CID 135042991 |
|---|---|
| PubChem CID | 135042991 |
| Molecular Formula | C15H21O |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | — |
| SMILES | CC(C)(O)CCC=CC[CH]c1ccccc1 |
| InChI | InChI=1S/C15H21O/c1-15(2,16)13-9-4-3-6-10-14-11-7-5-8-12-14/h3-5,7-8,10-12,16H,6,9,13H2,1-2H3 |
| InChIKey | ZKVOUFHRZSQSEM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|