C26H45B — CID 135048153
2,3-dimethylbutan-2-yl-[(1Z)-5-methyl-1-(4-methylcyclohex-3-en-1-ylidene)hex-4-enyl]-(4-methylpent-3-enyl)borane (PubChem CID 135048153) has the molecular formula C26H45B and a molecular weight of 368.46 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[(1Z)-5-methyl-1-(4-methylcyclohex-3-en-1-ylidene)hex-4-enyl]-(4-methylpent-3-enyl)borane.
| Compound Name | 2,3-dimethylbutan-2-yl-[(1Z)-5-methyl-1-(4-methylcyclohex-3-en-1-ylidene)hex-4-enyl]-(4-methylpent-3-enyl)borane |
|---|---|
| PubChem CID | 135048153 |
| Molecular Formula | C26H45B |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.36 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[(1Z)-5-methyl-1-(4-methylcyclohex-3-en-1-ylidene)hex-4-enyl]-(4-methylpent-3-enyl)borane |
| SMILES | CC(C)=CCCB(/C(CCC=C(C)C)=C1/CC=C(C)CC1)C(C)(C)C(C)C |
| InChI | InChI=1S/C26H45B/c1-20(2)12-10-14-25(24-17-15-23(7)16-18-24)27(19-11-13-21(3)4)26(8,9)22(5)6/h12-13,15,22H,10-11,14,16-19H2,1-9H3/b25-24- |
| InChIKey | GBUXTEZGXJULLT-IZHYLOQSSA-N |
| XLogP | 8.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|