C15H22N2O2 — CID 135048425
(1Z,2R)-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylpropan-2-ol (PubChem CID 135048425) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1Z,2R)-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylpropan-2-ol.
| Compound Name | (1Z,2R)-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 135048425 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (1Z,2R)-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-1-phenylpropan-2-ol |
| SMILES | COC[C@@H]1CCCN1/N=C(/c1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C15H22N2O2/c1-12(18)15(13-7-4-3-5-8-13)16-17-10-6-9-14(17)11-19-2/h3-5,7-8,12,14,18H,6,9-11H2,1-2H3/b16-15+/t12-,14+/m1/s1 |
| InChIKey | CWSMBQHGIRAPQL-UIUQPETLSA-N |
| XLogP | 1.88 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|