C20H21NO5S — CID 135051876
[4,4-dimethyl-1-(3-nitrophenyl)-1-phenylpent-2-ynyl] methanesulfonate (PubChem CID 135051876) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is [4,4-dimethyl-1-(3-nitrophenyl)-1-phenylpent-2-ynyl] methanesulfonate.
| Compound Name | [4,4-dimethyl-1-(3-nitrophenyl)-1-phenylpent-2-ynyl] methanesulfonate |
|---|---|
| PubChem CID | 135051876 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [4,4-dimethyl-1-(3-nitrophenyl)-1-phenylpent-2-ynyl] methanesulfonate |
| SMILES | CC(C)(C)C#CC(OS(C)(=O)=O)(c1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21NO5S/c1-19(2,3)13-14-20(26-27(4,24)25,16-9-6-5-7-10-16)17-11-8-12-18(15-17)21(22)23/h5-12,15H,1-4H3 |
| InChIKey | AYXBJAGVYQFRJX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|