C23H19ClN2OS — CID 135052753
4-chloro-2,5-bis(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide (PubChem CID 135052753) has the molecular formula C23H19ClN2OS and a molecular weight of 406.94 g/mol. Its IUPAC name is 4-chloro-2,5-bis(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide.
| Compound Name | 4-chloro-2,5-bis(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide |
|---|---|
| PubChem CID | 135052753 |
| Molecular Formula | C23H19ClN2OS |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 4-chloro-2,5-bis(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide |
| SMILES | Cc1ccc(C2=NS(=O)N(c3ccc(C)cc3)C(c3ccccc3)=C2Cl)cc1 |
| InChI | InChI=1S/C23H19ClN2OS/c1-16-8-12-18(13-9-16)22-21(24)23(19-6-4-3-5-7-19)26(28(27)25-22)20-14-10-17(2)11-15-20/h3-15H,1-2H3 |
| InChIKey | XQZFZDRZTQMRAO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |