C18H14F3NO2 — CID 135053147
2,2,2-trifluoro-N-[2-[3-hydroxy-3-(3-methylphenyl)prop-1-ynyl]phenyl]acetamide (PubChem CID 135053147) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[3-hydroxy-3-(3-methylphenyl)prop-1-ynyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[3-hydroxy-3-(3-methylphenyl)prop-1-ynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 135053147 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[3-hydroxy-3-(3-methylphenyl)prop-1-ynyl]phenyl]acetamide |
| SMILES | Cc1cccc(C(O)C#Cc2ccccc2NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3NO2/c1-12-5-4-7-14(11-12)16(23)10-9-13-6-2-3-8-15(13)22-17(24)18(19,20)21/h2-8,11,16,23H,1H3,(H,22,24) |
| InChIKey | MCVAKOOVJWEEKQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|