C22H21F2NO2S — CID 135053927
(1R)-3-(benzenesulfonyl)-N-benzyl-3,3-difluoro-1-phenylpropan-1-amine (PubChem CID 135053927) has the molecular formula C22H21F2NO2S and a molecular weight of 401.48 g/mol. Its IUPAC name is (1R)-3-(benzenesulfonyl)-N-benzyl-3,3-difluoro-1-phenylpropan-1-amine.
| Compound Name | (1R)-3-(benzenesulfonyl)-N-benzyl-3,3-difluoro-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 135053927 |
| Molecular Formula | C22H21F2NO2S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (1R)-3-(benzenesulfonyl)-N-benzyl-3,3-difluoro-1-phenylpropan-1-amine |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C[C@@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21F2NO2S/c23-22(24,28(26,27)20-14-8-3-9-15-20)16-21(19-12-6-2-7-13-19)25-17-18-10-4-1-5-11-18/h1-15,21,25H,16-17H2/t21-/m1/s1 |
| InChIKey | SUNFIIFIKZSQQC-OAQYLSRUSA-N |
| XLogP | 4.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |