C23H31N3O6Si — CID 135059598
methyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-nitrophenyl)-2-(pyridine-2-carbonylamino)butanoate (PubChem CID 135059598) has the molecular formula C23H31N3O6Si and a molecular weight of 473.60 g/mol. Its IUPAC name is methyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-nitrophenyl)-2-(pyridine-2-carbonylamino)butanoate.
| Compound Name | methyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-nitrophenyl)-2-(pyridine-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 135059598 |
| Molecular Formula | C23H31N3O6Si |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | methyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-nitrophenyl)-2-(pyridine-2-carbonylamino)butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccccn1)[C@@H](Cc1ccc([N+](=O)[O-])cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H31N3O6Si/c1-23(2,3)33(5,6)32-19(15-16-10-12-17(13-11-16)26(29)30)20(22(28)31-4)25-21(27)18-9-7-8-14-24-18/h7-14,19-20H,15H2,1-6H3,(H,25,27)/t19-,20+/m1/s1 |
| InChIKey | YUMOJHOBHSNDCQ-UXHICEINSA-N |
| XLogP | 3.89 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|