C27H38N2O6Si — CID 101144473
methyl (2S)-2-[[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methylbenzoyl]amino]-3-(4-nitrophenyl)propanoate (PubChem CID 101144473) has the molecular formula C27H38N2O6Si and a molecular weight of 514.70 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methylbenzoyl]amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methylbenzoyl]amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 101144473 |
| Molecular Formula | C27H38N2O6Si |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | methyl (2S)-2-[[2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methylbenzoyl]amino]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1c(C)cccc1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H38N2O6Si/c1-19-10-8-11-21(12-9-17-35-36(6,7)27(2,3)4)24(19)25(30)28-23(26(31)34-5)18-20-13-15-22(16-14-20)29(32)33/h8,10-11,13-16,23H,9,12,17-18H2,1-7H3,(H,28,30)/t23-/m0/s1 |
| InChIKey | IXGZUDRLEQXGCL-QHCPKHFHSA-N |
| XLogP | 5.37 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|