C10H6F4O2 — CID 135060222
2,2,2-trifluoro-1-[(2S,3R)-3-(4-fluorophenyl)oxiran-2-yl]ethanone (PubChem CID 135060222) has the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(2S,3R)-3-(4-fluorophenyl)oxiran-2-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(2S,3R)-3-(4-fluorophenyl)oxiran-2-yl]ethanone |
|---|---|
| PubChem CID | 135060222 |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2,2,2-trifluoro-1-[(2S,3R)-3-(4-fluorophenyl)oxiran-2-yl]ethanone |
| SMILES | O=C([C@H]1O[C@@H]1c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H6F4O2/c11-6-3-1-5(2-4-6)7-8(16-7)9(15)10(12,13)14/h1-4,7-8H/t7-,8+/m1/s1 |
| InChIKey | RCQXRAKIDICNDF-SFYZADRCSA-N |
| XLogP | 2.40 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|