C16H20F6O2 — CID 135061838
1-(4,4-diethoxybutyl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 135061838) has the molecular formula C16H20F6O2 and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-(4,4-diethoxybutyl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(4,4-diethoxybutyl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 135061838 |
| Molecular Formula | C16H20F6O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-(4,4-diethoxybutyl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCOC(CCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OCC |
| InChI | InChI=1S/C16H20F6O2/c1-3-23-14(24-4-2)7-5-6-11-8-12(15(17,18)19)10-13(9-11)16(20,21)22/h8-10,14H,3-7H2,1-2H3 |
| InChIKey | APAOPSDUZIXFMX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|