C17H18F6O3 — CID 145453104
2-[[3,5-bis(trifluoromethyl)phenyl]methyl]prop-2-enyl tert-butyl carbonate (PubChem CID 145453104) has the molecular formula C17H18F6O3 and a molecular weight of 384.32 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]prop-2-enyl tert-butyl carbonate.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]prop-2-enyl tert-butyl carbonate |
|---|---|
| PubChem CID | 145453104 |
| Molecular Formula | C17H18F6O3 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]prop-2-enyl tert-butyl carbonate |
| SMILES | C=C(COC(=O)OC(C)(C)C)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F6O3/c1-10(9-25-14(24)26-15(2,3)4)5-11-6-12(16(18,19)20)8-13(7-11)17(21,22)23/h6-8H,1,5,9H2,2-4H3 |
| InChIKey | JLVVHASSJDEXNC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|