C23H20F6N2O3 — CID 135061849
(1Z)-N-[6-[(4-methoxycarbonylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135061849) has the molecular formula C23H20F6N2O3 and a molecular weight of 486.41 g/mol. Its IUPAC name is (1Z)-N-[6-[(4-methoxycarbonylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-[6-[(4-methoxycarbonylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135061849 |
| Molecular Formula | C23H20F6N2O3 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (1Z)-N-[6-[(4-methoxycarbonylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | COC(=O)c1ccc(CC2=[N+](/N=C(\[O-])c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCCC2)cc1 |
| InChI | InChI=1S/C23H20F6N2O3/c1-34-21(33)15-7-5-14(6-8-15)10-19-4-2-3-9-31(19)30-20(32)16-11-17(22(24,25)26)13-18(12-16)23(27,28)29/h5-8,11-13H,2-4,9-10H2,1H3 |
| InChIKey | MKJBZKQKWXJPLK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|