C18H26O8 — CID 135061908
(6E)-15,16-dimethoxy-15,16-dimethyl-8-methylidene-3,11,14,17-tetraoxabicyclo[11.4.0]heptadec-6-ene-2,12-dione (PubChem CID 135061908) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is (6E)-15,16-dimethoxy-15,16-dimethyl-8-methylidene-3,11,14,17-tetraoxabicyclo[11.4.0]heptadec-6-ene-2,12-dione.
| Compound Name | (6E)-15,16-dimethoxy-15,16-dimethyl-8-methylidene-3,11,14,17-tetraoxabicyclo[11.4.0]heptadec-6-ene-2,12-dione |
|---|---|
| PubChem CID | 135061908 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (6E)-15,16-dimethoxy-15,16-dimethyl-8-methylidene-3,11,14,17-tetraoxabicyclo[11.4.0]heptadec-6-ene-2,12-dione |
| SMILES | C=C1/C=C/CCOC(=O)C2OC(C)(OC)C(C)(OC)OC2C(=O)OCC1 |
| InChI | InChI=1S/C18H26O8/c1-12-8-6-7-10-23-15(19)13-14(16(20)24-11-9-12)26-18(3,22-5)17(2,21-4)25-13/h6,8,13-14H,1,7,9-11H2,2-5H3/b8-6+ |
| InChIKey | HVXIYAQKOPYXIV-SOFGYWHQSA-N |
| XLogP | 1.49 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |