C19H28O8 — CID 135062106
(6E)-7-ethenyl-15,16-dimethoxy-15,16-dimethyl-3,11,14,17-tetraoxabicyclo[11.4.0]heptadec-6-ene-2,12-dione (PubChem CID 135062106) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is (6E)-7-ethenyl-15,16-dimethoxy-15,16-dimethyl-3,11,14,17-tetraoxabicyclo[11.4.0]heptadec-6-ene-2,12-dione.
| Compound Name | (6E)-7-ethenyl-15,16-dimethoxy-15,16-dimethyl-3,11,14,17-tetraoxabicyclo[11.4.0]heptadec-6-ene-2,12-dione |
|---|---|
| PubChem CID | 135062106 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (6E)-7-ethenyl-15,16-dimethoxy-15,16-dimethyl-3,11,14,17-tetraoxabicyclo[11.4.0]heptadec-6-ene-2,12-dione |
| SMILES | C=C/C1=C/CCOC(=O)C2OC(C)(OC)C(C)(OC)OC2C(=O)OCCC1 |
| InChI | InChI=1S/C19H28O8/c1-6-13-9-7-11-24-16(20)14-15(17(21)25-12-8-10-13)27-19(3,23-5)18(2,22-4)26-14/h6,9,14-15H,1,7-8,10-12H2,2-5H3/b13-9- |
| InChIKey | NTYWBKVWUBEPDX-LCYFTJDESA-N |
| XLogP | 1.88 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |