C19H19BrClNO5S — CID 135062241
ethyl (2R,3R)-4-(4-bromophenyl)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoate (PubChem CID 135062241) has the molecular formula C19H19BrClNO5S and a molecular weight of 488.79 g/mol. Its IUPAC name is ethyl (2R,3R)-4-(4-bromophenyl)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoate.
| Compound Name | ethyl (2R,3R)-4-(4-bromophenyl)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 135062241 |
| Molecular Formula | C19H19BrClNO5S |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | ethyl (2R,3R)-4-(4-bromophenyl)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](Cl)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrClNO5S/c1-3-27-19(24)17(16(21)18(23)13-6-8-14(20)9-7-13)22-28(25,26)15-10-4-12(2)5-11-15/h4-11,16-17,22H,3H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | FTRAUMXSPRGZNQ-SJORKVTESA-N |
| XLogP | 3.46 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|