C21H24ClNO5S — CID 135064586
tert-butyl (2R,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate (PubChem CID 135064586) has the molecular formula C21H24ClNO5S and a molecular weight of 437.95 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate.
| Compound Name | tert-butyl (2R,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 135064586 |
| Molecular Formula | C21H24ClNO5S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | tert-butyl (2R,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C(=O)OC(C)(C)C)[C@@H](Cl)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24ClNO5S/c1-14-10-12-16(13-11-14)29(26,27)23-18(20(25)28-21(2,3)4)17(22)19(24)15-8-6-5-7-9-15/h5-13,17-18,23H,1-4H3/t17-,18+/m1/s1 |
| InChIKey | FPEUPFPLYBNXQB-MSOLQXFVSA-N |
| XLogP | 3.47 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|