C20H20ClNO5S — CID 135064587
ethyl (2S)-2-[(2S)-2-chloro-3-oxo-1H-inden-2-yl]-2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 135064587) has the molecular formula C20H20ClNO5S and a molecular weight of 421.90 g/mol. Its IUPAC name is ethyl (2S)-2-[(2S)-2-chloro-3-oxo-1H-inden-2-yl]-2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | ethyl (2S)-2-[(2S)-2-chloro-3-oxo-1H-inden-2-yl]-2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 135064587 |
| Molecular Formula | C20H20ClNO5S |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | ethyl (2S)-2-[(2S)-2-chloro-3-oxo-1H-inden-2-yl]-2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | CCOC(=O)[C@H](NS(=O)(=O)c1ccc(C)cc1)[C@@]1(Cl)Cc2ccccc2C1=O |
| InChI | InChI=1S/C20H20ClNO5S/c1-3-27-19(24)17(22-28(25,26)15-10-8-13(2)9-11-15)20(21)12-14-6-4-5-7-16(14)18(20)23/h4-11,17,22H,3,12H2,1-2H3/t17-,20-/m0/s1 |
| InChIKey | JLAKVYSPHWIREK-PXNSSMCTSA-N |
| XLogP | 2.62 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|