C16H24O4 — CID 135066984
dimethyl (1R,6R,9S)-tricyclo[7.2.1.01,6]dodecane-10,10-dicarboxylate (PubChem CID 135066984) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is dimethyl (1R,6R,9S)-tricyclo[7.2.1.01,6]dodecane-10,10-dicarboxylate.
| Compound Name | dimethyl (1R,6R,9S)-tricyclo[7.2.1.01,6]dodecane-10,10-dicarboxylate |
|---|---|
| PubChem CID | 135066984 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | dimethyl (1R,6R,9S)-tricyclo[7.2.1.01,6]dodecane-10,10-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@]23CCCC[C@@H]2CC[C@H]1C3 |
| InChI | InChI=1S/C16H24O4/c1-19-13(17)16(14(18)20-2)10-15-8-4-3-5-11(15)6-7-12(16)9-15/h11-12H,3-10H2,1-2H3/t11-,12+,15-/m1/s1 |
| InChIKey | QHDZGPSAYVSVLL-TYNCELHUSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|