C21H37NO4Si — CID 135067861
trans-ethyl (1S,2S)-1-[(1Z,3E)-4-[tert-butyl(dimethyl)silyl]oxybuta-1,3-dienyl]-2-(diethylcarbamoyl)cyclopropane-1-carboxylate (PubChem CID 135067861) has the molecular formula C21H37NO4Si and a molecular weight of 395.62 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-1-[(1Z,3E)-4-[tert-butyl(dimethyl)silyl]oxybuta-1,3-dienyl]-2-(diethylcarbamoyl)cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-1-[(1Z,3E)-4-[tert-butyl(dimethyl)silyl]oxybuta-1,3-dienyl]-2-(diethylcarbamoyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 135067861 |
| Molecular Formula | C21H37NO4Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | trans-ethyl (1S,2S)-1-[(1Z,3E)-4-[tert-butyl(dimethyl)silyl]oxybuta-1,3-dienyl]-2-(diethylcarbamoyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(/C=C\C=C\O[Si](C)(C)C(C)(C)C)C[C@@H]1C(=O)N(CC)CC |
| InChI | InChI=1S/C21H37NO4Si/c1-9-22(10-2)18(23)17-16-21(17,19(24)25-11-3)14-12-13-15-26-27(7,8)20(4,5)6/h12-15,17H,9-11,16H2,1-8H3/b14-12-,15-13+/t17-,21-/m1/s1 |
| InChIKey | WWNUHXYWYGAGQG-BMGNFLSWSA-N |
| XLogP | 4.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|