C20H24O3 — CID 135068918
methyl 2-(4-phenylpenta-1,4-dien-2-yl)-5-propyl-2,3-dihydrofuran-4-carboxylate (PubChem CID 135068918) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 2-(4-phenylpenta-1,4-dien-2-yl)-5-propyl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | methyl 2-(4-phenylpenta-1,4-dien-2-yl)-5-propyl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 135068918 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | methyl 2-(4-phenylpenta-1,4-dien-2-yl)-5-propyl-2,3-dihydrofuran-4-carboxylate |
| SMILES | C=C(CC(=C)C1CC(C(=O)OC)=C(CCC)O1)c1ccccc1 |
| InChI | InChI=1S/C20H24O3/c1-5-9-18-17(20(21)22-4)13-19(23-18)15(3)12-14(2)16-10-7-6-8-11-16/h6-8,10-11,19H,2-3,5,9,12-13H2,1,4H3 |
| InChIKey | LQZNOUFDMJHTQZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|