C23H29NO2SSi — CID 135069932
triethyl-[5-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]hex-5-en-1,3-diynyl]silane (PubChem CID 135069932) has the molecular formula C23H29NO2SSi and a molecular weight of 411.64 g/mol. Its IUPAC name is triethyl-[5-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]hex-5-en-1,3-diynyl]silane.
| Compound Name | triethyl-[5-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]hex-5-en-1,3-diynyl]silane |
|---|---|
| PubChem CID | 135069932 |
| Molecular Formula | C23H29NO2SSi |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | triethyl-[5-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]hex-5-en-1,3-diynyl]silane |
| SMILES | C=C(C#CC#C[Si](CC)(CC)CC)C1=CCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C23H29NO2SSi/c1-6-28(7-2,8-3)18-10-9-11-21(5)22-16-17-24(19-22)27(25,26)23-14-12-20(4)13-15-23/h12-16H,5-8,17,19H2,1-4H3 |
| InChIKey | XOHBNCQRAVIVJS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|