C13H32O2Si2 — CID 135070735
[3,3-dimethyl-2-(trimethylsilyloxymethyl)butoxy]-trimethylsilane (PubChem CID 135070735) has the molecular formula C13H32O2Si2 and a molecular weight of 276.57 g/mol. Its IUPAC name is [3,3-dimethyl-2-(trimethylsilyloxymethyl)butoxy]-trimethylsilane.
| Compound Name | [3,3-dimethyl-2-(trimethylsilyloxymethyl)butoxy]-trimethylsilane |
|---|---|
| PubChem CID | 135070735 |
| Molecular Formula | C13H32O2Si2 |
| Molecular Weight | 276.57 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [3,3-dimethyl-2-(trimethylsilyloxymethyl)butoxy]-trimethylsilane |
| SMILES | CC(C)(C)C(CO[Si](C)(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C13H32O2Si2/c1-13(2,3)12(10-14-16(4,5)6)11-15-17(7,8)9/h12H,10-11H2,1-9H3 |
| InChIKey | MJNFUQRXOGBVMZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|