C24H60O7Si5 — CID 91696506
1,3-bis[2,3-bis(trimethylsilyloxy)propoxy]propan-2-yloxy-trimethylsilane (PubChem CID 91696506) has the molecular formula C24H60O7Si5 and a molecular weight of 601.17 g/mol. Its IUPAC name is 1,3-bis[2,3-bis(trimethylsilyloxy)propoxy]propan-2-yloxy-trimethylsilane.
| Compound Name | 1,3-bis[2,3-bis(trimethylsilyloxy)propoxy]propan-2-yloxy-trimethylsilane |
|---|---|
| PubChem CID | 91696506 |
| Molecular Formula | C24H60O7Si5 |
| Molecular Weight | 601.17 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | 1,3-bis[2,3-bis(trimethylsilyloxy)propoxy]propan-2-yloxy-trimethylsilane |
| SMILES | C[Si](C)(C)OCC(COCC(COCC(CO[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H60O7Si5/c1-32(2,3)27-20-23(30-35(10,11)12)18-25-16-22(29-34(7,8)9)17-26-19-24(31-36(13,14)15)21-28-33(4,5)6/h22-24H,16-21H2,1-15H3 |
| InChIKey | KJCCAJSTBLHNFN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.17 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|