C14H35ClO3Si3 — CID 22137822
3-[2,3-bis(trimethylsilyloxy)propoxy]propyl-chloro-dimethylsilane (PubChem CID 22137822) has the molecular formula C14H35ClO3Si3 and a molecular weight of 371.14 g/mol. Its IUPAC name is 3-[2,3-bis(trimethylsilyloxy)propoxy]propyl-chloro-dimethylsilane.
| Compound Name | 3-[2,3-bis(trimethylsilyloxy)propoxy]propyl-chloro-dimethylsilane |
|---|---|
| PubChem CID | 22137822 |
| Molecular Formula | C14H35ClO3Si3 |
| Molecular Weight | 371.14 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[2,3-bis(trimethylsilyloxy)propoxy]propyl-chloro-dimethylsilane |
| SMILES | C[Si](C)(Cl)CCCOCC(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H35ClO3Si3/c1-19(2,3)17-13-14(18-20(4,5)6)12-16-10-9-11-21(7,8)15/h14H,9-13H2,1-8H3 |
| InChIKey | WKQLQKYBYIEFPI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.14 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|