C13H32OSi2 — CID 58999187
trimethyl-(2,2,3-trimethyl-3-trimethylsilylbutoxy)silane (PubChem CID 58999187) has the molecular formula C13H32OSi2 and a molecular weight of 260.57 g/mol. Its IUPAC name is trimethyl-(2,2,3-trimethyl-3-trimethylsilylbutoxy)silane.
| Compound Name | trimethyl-(2,2,3-trimethyl-3-trimethylsilylbutoxy)silane |
|---|---|
| PubChem CID | 58999187 |
| Molecular Formula | C13H32OSi2 |
| Molecular Weight | 260.57 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | trimethyl-(2,2,3-trimethyl-3-trimethylsilylbutoxy)silane |
| SMILES | CC(C)(CO[Si](C)(C)C)C(C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C13H32OSi2/c1-12(2,11-14-16(8,9)10)13(3,4)15(5,6)7/h11H2,1-10H3 |
| InChIKey | VUYHYPJECQYTBE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|