C17H14F2O3S — CID 135070766
[4-(benzenesulfonyl)-4,4-difluorobut-2-ynoxy]methylbenzene (PubChem CID 135070766) has the molecular formula C17H14F2O3S and a molecular weight of 336.36 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-4,4-difluorobut-2-ynoxy]methylbenzene.
| Compound Name | [4-(benzenesulfonyl)-4,4-difluorobut-2-ynoxy]methylbenzene |
|---|---|
| PubChem CID | 135070766 |
| Molecular Formula | C17H14F2O3S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [4-(benzenesulfonyl)-4,4-difluorobut-2-ynoxy]methylbenzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C#CCOCc1ccccc1 |
| InChI | InChI=1S/C17H14F2O3S/c18-17(19,23(20,21)16-10-5-2-6-11-16)12-7-13-22-14-15-8-3-1-4-9-15/h1-6,8-11H,13-14H2 |
| InChIKey | BUDPDWFIIOOISU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|